C15H28FN — CID 139501108
5-butan-2-yl-1-fluoro-2,4-dimethyl-6-propan-2-yl-2,3,4,7-tetrahydroazepine (PubChem CID 139501108) has the molecular formula C15H28FN and a molecular weight of 241.39 g/mol. Its IUPAC name is 5-butan-2-yl-1-fluoro-2,4-dimethyl-6-propan-2-yl-2,3,4,7-tetrahydroazepine.
| Compound Name | 5-butan-2-yl-1-fluoro-2,4-dimethyl-6-propan-2-yl-2,3,4,7-tetrahydroazepine |
|---|---|
| PubChem CID | 139501108 |
| Molecular Formula | C15H28FN |
| Molecular Weight | 241.39 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 5-butan-2-yl-1-fluoro-2,4-dimethyl-6-propan-2-yl-2,3,4,7-tetrahydroazepine |
| SMILES | CCC(C)C1=C(C(C)C)CN(F)C(C)CC1C |
| InChI | InChI=1S/C15H28FN/c1-7-11(4)15-12(5)8-13(6)17(16)9-14(15)10(2)3/h10-13H,7-9H2,1-6H3 |
| InChIKey | TXWGOAZWKPXCMM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|