C13H24FN — CID 139318274
1-fluoro-2,3-dimethyl-4,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine (PubChem CID 139318274) has the molecular formula C13H24FN and a molecular weight of 213.34 g/mol. Its IUPAC name is 1-fluoro-2,3-dimethyl-4,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-fluoro-2,3-dimethyl-4,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 139318274 |
| Molecular Formula | C13H24FN |
| Molecular Weight | 213.34 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | 1-fluoro-2,3-dimethyl-4,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)C1=C(C(C)C)C(C)C(C)N(F)C1 |
| InChI | InChI=1S/C13H24FN/c1-8(2)12-7-15(14)11(6)10(5)13(12)9(3)4/h8-11H,7H2,1-6H3 |
| InChIKey | WMZPXFPTPFNYCP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|