C16H33N — CID 145202317
ethane;5-methyl-4-(3-methylbutan-2-yl)-1-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 145202317) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is ethane;5-methyl-4-(3-methylbutan-2-yl)-1-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | ethane;5-methyl-4-(3-methylbutan-2-yl)-1-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 145202317 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | ethane;5-methyl-4-(3-methylbutan-2-yl)-1-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC.CC1=C(C(C)C(C)C)CCN(C(C)C)C1 |
| InChI | InChI=1S/C14H27N.C2H6/c1-10(2)13(6)14-7-8-15(11(3)4)9-12(14)5;1-2/h10-11,13H,7-9H2,1-6H3;1-2H3 |
| InChIKey | SYJRXEWZYPWCJW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|