C12H14N2O2 — CID 139504537
[2-(1,4-dimethylpyrazol-5-yl)phenyl]methanediol (PubChem CID 139504537) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is [2-(1,4-dimethylpyrazol-5-yl)phenyl]methanediol.
| Compound Name | [2-(1,4-dimethylpyrazol-5-yl)phenyl]methanediol |
|---|---|
| PubChem CID | 139504537 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | [2-(1,4-dimethylpyrazol-5-yl)phenyl]methanediol |
| SMILES | Cc1cnn(C)c1-c1ccccc1C(O)O |
| InChI | InChI=1S/C12H14N2O2/c1-8-7-13-14(2)11(8)9-5-3-4-6-10(9)12(15)16/h3-7,12,15-16H,1-2H3 |
| InChIKey | HYECSGNVAGAANR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|