About {2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol
{2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol (PubChem CID 24229659) has the molecular formula C12H11F3N2O
and a molecular weight of 256.22 g/mol. Its IUPAC name is [2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methanol.
Molecular Properties
| Compound Name | {2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol |
| PubChem CID | 24229659 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methanol |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C2=CC=CC=C2CO |
| InChI | InChI=1S/C12H11F3N2O/c1-17-10(6-11(16-17)12(13,14)15)9-5-3-2-4-8(9)7-18/h2-6,18H,7H2,1H3 |
| InChIKey | HLMRFDCLSUXVQC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 285 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze {2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of {2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol?
The IUPAC name of {2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol (CID 24229659) is [2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]methanol.
What is the SMILES notation for {2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol?
The canonical SMILES for {2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol is CN1C(=CC(=N1)C(F)(F)F)C2=CC=CC=C2CO.
What is the InChIKey of {2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol?
The InChIKey is HLMRFDCLSUXVQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2O/c1-17-10(6-11(16-17)12(13,14)15)9-5-3-2-4-8(9)7-18/h2-6,18H,7H2,1H3.
What are the key properties of {2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol?
{2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol has a molecular weight of 256.22 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for {2-[1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]phenyl}methanol is sourced from PubChem (CID 24229659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).