C26H27FN2O5 — CID 139505303
4-[(Z)-[3-[2-amino-1-(furan-2-ylmethylamino)-2-hydroxyethyl]-5-fluoro-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenol (PubChem CID 139505303) has the molecular formula C26H27FN2O5 and a molecular weight of 466.51 g/mol. Its IUPAC name is 4-[(Z)-[3-[2-amino-1-(furan-2-ylmethylamino)-2-hydroxyethyl]-5-fluoro-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(Z)-[3-[2-amino-1-(furan-2-ylmethylamino)-2-hydroxyethyl]-5-fluoro-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 139505303 |
| Molecular Formula | C26H27FN2O5 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 4-[(Z)-[3-[2-amino-1-(furan-2-ylmethylamino)-2-hydroxyethyl]-5-fluoro-2-methylinden-1-ylidene]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(/C=C2/C(C)=C(C(NCc3ccco3)C(N)O)c3cc(F)ccc32)cc(OC)c1O |
| InChI | InChI=1S/C26H27FN2O5/c1-14-19(9-15-10-21(32-2)25(30)22(11-15)33-3)18-7-6-16(27)12-20(18)23(14)24(26(28)31)29-13-17-5-4-8-34-17/h4-12,24,26,29-31H,13,28H2,1-3H3/b19-9- |
| InChIKey | RKEMDTFXLHYVJD-OCKHKDLRSA-N |
| XLogP | 3.90 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|