C20H20N4O2S — CID 139505552
[[(1R)-1-(3-methoxyphenyl)ethyl]amino]-[6-(1H-pyrazol-4-yl)thieno[2,3-b]pyridin-2-yl]methanol (PubChem CID 139505552) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is [[(1R)-1-(3-methoxyphenyl)ethyl]amino]-[6-(1H-pyrazol-4-yl)thieno[2,3-b]pyridin-2-yl]methanol.
| Compound Name | [[(1R)-1-(3-methoxyphenyl)ethyl]amino]-[6-(1H-pyrazol-4-yl)thieno[2,3-b]pyridin-2-yl]methanol |
|---|---|
| PubChem CID | 139505552 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [[(1R)-1-(3-methoxyphenyl)ethyl]amino]-[6-(1H-pyrazol-4-yl)thieno[2,3-b]pyridin-2-yl]methanol |
| SMILES | COc1cccc([C@@H](C)NC(O)c2cc3ccc(-c4cn[nH]c4)nc3s2)c1 |
| InChI | InChI=1S/C20H20N4O2S/c1-12(13-4-3-5-16(8-13)26-2)23-19(25)18-9-14-6-7-17(24-20(14)27-18)15-10-21-22-11-15/h3-12,19,23,25H,1-2H3,(H,21,22)/t12-,19?/m1/s1 |
| InChIKey | RTONJXOGBNODJM-ISGGMURCSA-N |
| XLogP | 4.04 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|