C12H15NS — CID 139505736
5-cyclohexa-1,3-dien-1-yl-2-propan-2-yl-1,3-thiazole (PubChem CID 139505736) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 5-cyclohexa-1,3-dien-1-yl-2-propan-2-yl-1,3-thiazole.
| Compound Name | 5-cyclohexa-1,3-dien-1-yl-2-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 139505736 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5-cyclohexa-1,3-dien-1-yl-2-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1ncc(C2=CC=CCC2)s1 |
| InChI | InChI=1S/C12H15NS/c1-9(2)12-13-8-11(14-12)10-6-4-3-5-7-10/h3-4,6,8-9H,5,7H2,1-2H3 |
| InChIKey | WHLLHKFEOOAXTQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |