About [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate
[3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate (PubChem CID 139506523) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate.
Molecular Properties
| Compound Name | [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate |
| PubChem CID | 139506523 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate |
| SMILES | CNC1=CC=C(C)C=C(COC=O)C1 |
| InChI | InChI=1S/C11H15NO2/c1-9-3-4-11(12-2)6-10(5-9)7-14-8-13/h3-5,8,12H,6-7H2,1-2H3 |
| InChIKey | HMBIPVWBXDRNDX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate?
The IUPAC name of [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate (CID 139506523) is [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate.
What is the SMILES notation for [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate?
The canonical SMILES for [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate is CNC1=CC=C(C)C=C(COC=O)C1.
What is the InChIKey of [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate?
The InChIKey is HMBIPVWBXDRNDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-9-3-4-11(12-2)6-10(5-9)7-14-8-13/h3-5,8,12H,6-7H2,1-2H3.
What are the key properties of [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate?
[3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate has a molecular weight of 193.25 g/mol, XLogP of 1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-6-(methylamino)cyclohepta-1,3,5-trien-1-yl]methyl formate is sourced from PubChem (CID 139506523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).