C10H15NO2 — CID 146187277
[(2E,3Z)-2-ethylidene-5-(methylamino)hexa-3,5-dienyl] formate (PubChem CID 146187277) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is [(2E,3Z)-2-ethylidene-5-(methylamino)hexa-3,5-dienyl] formate.
| Compound Name | [(2E,3Z)-2-ethylidene-5-(methylamino)hexa-3,5-dienyl] formate |
|---|---|
| PubChem CID | 146187277 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | [(2E,3Z)-2-ethylidene-5-(methylamino)hexa-3,5-dienyl] formate |
| SMILES | C=C(/C=C\C(=C/C)COC=O)NC |
| InChI | InChI=1S/C10H15NO2/c1-4-10(7-13-8-12)6-5-9(2)11-3/h4-6,8,11H,2,7H2,1,3H3/b6-5-,10-4+ |
| InChIKey | DWIWIJDBBJQPTM-QYONPMAVSA-N |
| XLogP | 1.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|