C16H18BrNO3S — CID 139510251
3-(3-bromophenyl)azetidine;4-methylbenzenesulfonic acid (PubChem CID 139510251) has the molecular formula C16H18BrNO3S and a molecular weight of 384.30 g/mol. Its IUPAC name is 3-(3-bromophenyl)azetidine;4-methylbenzenesulfonic acid.
| Compound Name | 3-(3-bromophenyl)azetidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 139510251 |
| Molecular Formula | C16H18BrNO3S |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 3-(3-bromophenyl)azetidine;4-methylbenzenesulfonic acid |
| SMILES | Brc1cccc(C2CNC2)c1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H10BrN.C7H8O3S/c10-9-3-1-2-7(4-9)8-5-11-6-8;1-6-2-4-7(5-3-6)11(8,9)10/h1-4,8,11H,5-6H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | KMEQTOLVSFNCPU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|