C9H10N2O4 — CID 139512246
methyl 1-(oxetan-3-yl)-6-oxopyridazine-3-carboxylate (PubChem CID 139512246) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is methyl 1-(oxetan-3-yl)-6-oxopyridazine-3-carboxylate.
| Compound Name | methyl 1-(oxetan-3-yl)-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 139512246 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | methyl 1-(oxetan-3-yl)-6-oxopyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(=O)n(C2COC2)n1 |
| InChI | InChI=1S/C9H10N2O4/c1-14-9(13)7-2-3-8(12)11(10-7)6-4-15-5-6/h2-3,6H,4-5H2,1H3 |
| InChIKey | FSIBXPWXGHPDEO-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |