C18H22N2O3S — CID 166249488
methyl 1-(6-oxaspiro[4.5]decan-9-yl)-5-thiophen-2-ylpyrazole-3-carboxylate (PubChem CID 166249488) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is methyl 1-(6-oxaspiro[4.5]decan-9-yl)-5-thiophen-2-ylpyrazole-3-carboxylate.
| Compound Name | methyl 1-(6-oxaspiro[4.5]decan-9-yl)-5-thiophen-2-ylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 166249488 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | methyl 1-(6-oxaspiro[4.5]decan-9-yl)-5-thiophen-2-ylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccs2)n(C2CCOC3(CCCC3)C2)n1 |
| InChI | InChI=1S/C18H22N2O3S/c1-22-17(21)14-11-15(16-5-4-10-24-16)20(19-14)13-6-9-23-18(12-13)7-2-3-8-18/h4-5,10-11,13H,2-3,6-9,12H2,1H3 |
| InChIKey | IGOCPEZCRJUCJW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |