C14H20O — CID 139513640
3-pentan-2-yl-3,4-dihydro-2H-chromene (PubChem CID 139513640) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 3-pentan-2-yl-3,4-dihydro-2H-chromene.
| Compound Name | 3-pentan-2-yl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 139513640 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 3-pentan-2-yl-3,4-dihydro-2H-chromene |
| SMILES | CCCC(C)C1COc2ccccc2C1 |
| InChI | InChI=1S/C14H20O/c1-3-6-11(2)13-9-12-7-4-5-8-14(12)15-10-13/h4-5,7-8,11,13H,3,6,9-10H2,1-2H3 |
| InChIKey | YNKMYOSBYVZXCN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |