C25H28N2O2 — CID 139513922
[5-(1-benzylpiperidin-4-yl)-4-oxa-7-azaspiro[2.5]oct-5-en-7-yl]-phenylmethanone (PubChem CID 139513922) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is [5-(1-benzylpiperidin-4-yl)-4-oxa-7-azaspiro[2.5]oct-5-en-7-yl]-phenylmethanone.
| Compound Name | [5-(1-benzylpiperidin-4-yl)-4-oxa-7-azaspiro[2.5]oct-5-en-7-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139513922 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [5-(1-benzylpiperidin-4-yl)-4-oxa-7-azaspiro[2.5]oct-5-en-7-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1C=C(C2CCN(Cc3ccccc3)CC2)OC2(CC2)C1 |
| InChI | InChI=1S/C25H28N2O2/c28-24(22-9-5-2-6-10-22)27-18-23(29-25(19-27)13-14-25)21-11-15-26(16-12-21)17-20-7-3-1-4-8-20/h1-10,18,21H,11-17,19H2 |
| InChIKey | GMXVJRRZYOXJOK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |