C23H24N6O2S — CID 139515235
N-[2-methyl-5-[5-(1-methylsulfanylpiperidin-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 139515235) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-[2-methyl-5-[5-(1-methylsulfanylpiperidin-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[2-methyl-5-[5-(1-methylsulfanylpiperidin-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139515235 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-[2-methyl-5-[5-(1-methylsulfanylpiperidin-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CSN1CCCCC1c1nc(-c2ccc(C)c(NC(=O)c3cnc4ccccn34)c2)no1 |
| InChI | InChI=1S/C23H24N6O2S/c1-15-9-10-16(21-26-23(31-27-21)18-7-3-6-12-29(18)32-2)13-17(15)25-22(30)19-14-24-20-8-4-5-11-28(19)20/h4-5,8-11,13-14,18H,3,6-7,12H2,1-2H3,(H,25,30) |
| InChIKey | OHPINKRRSZCPHJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|