C11H19NO — CID 139515391
3-[3-methylbuta-1,3-dien-2-yl(prop-2-enyl)amino]propan-1-ol (PubChem CID 139515391) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-[3-methylbuta-1,3-dien-2-yl(prop-2-enyl)amino]propan-1-ol.
| Compound Name | 3-[3-methylbuta-1,3-dien-2-yl(prop-2-enyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 139515391 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-[3-methylbuta-1,3-dien-2-yl(prop-2-enyl)amino]propan-1-ol |
| SMILES | C=CCN(CCCO)C(=C)C(=C)C |
| InChI | InChI=1S/C11H19NO/c1-5-7-12(8-6-9-13)11(4)10(2)3/h5,13H,1-2,4,6-9H2,3H3 |
| InChIKey | XAAJOYSSSHJXAV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|