C14H27NO — CID 156818173
ethane;4-[methyl-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]amino]butan-2-ol (PubChem CID 156818173) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is ethane;4-[methyl-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]amino]butan-2-ol.
| Compound Name | ethane;4-[methyl-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]amino]butan-2-ol |
|---|---|
| PubChem CID | 156818173 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | ethane;4-[methyl-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]amino]butan-2-ol |
| SMILES | C=C/C(C)=C\C(=C)N(C)CCC(C)O.CC |
| InChI | InChI=1S/C12H21NO.C2H6/c1-6-10(2)9-11(3)13(5)8-7-12(4)14;1-2/h6,9,12,14H,1,3,7-8H2,2,4-5H3;1-2H3/b10-9-; |
| InChIKey | LXLHTLWKABGSSO-KVVVOXFISA-N |
| XLogP | 3.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|