C40H25N5 — CID 139516524
15-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14,16-diazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene (PubChem CID 139516524) has the molecular formula C40H25N5 and a molecular weight of 575.68 g/mol. Its IUPAC name is 15-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14,16-diazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene.
| Compound Name | 15-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14,16-diazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene |
|---|---|
| PubChem CID | 139516524 |
| Molecular Formula | C40H25N5 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 15-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-14,16-diazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4nc5cccc6c5n4-c4ccccc4-c4ccccc4-6)cc3)n2)cc1 |
| InChI | InChI=1S/C40H25N5/c1-3-12-26(13-4-1)37-42-38(27-14-5-2-6-15-27)44-39(43-37)28-22-24-29(25-23-28)40-41-34-20-11-19-33-31-17-8-7-16-30(31)32-18-9-10-21-35(32)45(40)36(33)34/h1-25H |
| InChIKey | DZCQCUKFUHTGGI-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |