C19H16FN5O — CID 139521752
N-[5-[(3-fluorophenyl)methyl]-2-pyridinyl]-6-imino-1-methanimidoylpyridine-3-carboxamide (PubChem CID 139521752) has the molecular formula C19H16FN5O and a molecular weight of 349.37 g/mol. Its IUPAC name is N-[5-[(3-fluorophenyl)methyl]-2-pyridinyl]-6-imino-1-methanimidoylpyridine-3-carboxamide.
| Compound Name | N-[5-[(3-fluorophenyl)methyl]-2-pyridinyl]-6-imino-1-methanimidoylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 139521752 |
| Molecular Formula | C19H16FN5O |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-[5-[(3-fluorophenyl)methyl]-2-pyridinyl]-6-imino-1-methanimidoylpyridine-3-carboxamide |
| SMILES | [H]/N=C/n1cc(C(=O)Nc2ccc(Cc3cccc(F)c3)cn2)cc/c1=N\[H] |
| InChI | InChI=1S/C19H16FN5O/c20-16-3-1-2-13(9-16)8-14-4-7-18(23-10-14)24-19(26)15-5-6-17(22)25(11-15)12-21/h1-7,9-12,21-22H,8H2,(H,23,24,26)/b21-12+,22-17+ |
| InChIKey | KIAJGBDMDCFMBC-HYELQYBJSA-N |
| XLogP | 2.80 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|