C30H54S — CID 139524548
2-propan-2-yl-5-(4,4,13,14-tetramethyl-1,2,3,5,6,7,8,9,10,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)hexane-1-thiol (PubChem CID 139524548) has the molecular formula C30H54S and a molecular weight of 446.83 g/mol. Its IUPAC name is 2-propan-2-yl-5-(4,4,13,14-tetramethyl-1,2,3,5,6,7,8,9,10,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)hexane-1-thiol.
| Compound Name | 2-propan-2-yl-5-(4,4,13,14-tetramethyl-1,2,3,5,6,7,8,9,10,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)hexane-1-thiol |
|---|---|
| PubChem CID | 139524548 |
| Molecular Formula | C30H54S |
| Molecular Weight | 446.83 g/mol |
| Exact Mass | 446.39 |
| IUPAC Name | 2-propan-2-yl-5-(4,4,13,14-tetramethyl-1,2,3,5,6,7,8,9,10,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)hexane-1-thiol |
| SMILES | CC(C)C(CS)CCC(C)C1CCC2(C)C3CCC4C(CCCC4(C)C)C3CCC12C |
| InChI | InChI=1S/C30H54S/c1-20(2)22(19-31)11-10-21(3)25-15-18-30(7)27-13-12-26-23(9-8-16-28(26,4)5)24(27)14-17-29(25,30)6/h20-27,31H,8-19H2,1-7H3 |
| InChIKey | VDSXAEQXWFRLSC-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.83 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|