C30H52 — CID 91746588
(1S,3R,7R,8S,11S,12S,15R,16R)-15-[(2R,5S)-5,6-dimethylheptan-2-yl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane (PubChem CID 91746588) has the molecular formula C30H52 and a molecular weight of 412.75 g/mol. Its IUPAC name is (1S,3R,7R,8S,11S,12S,15R,16R)-15-[(2R,5S)-5,6-dimethylheptan-2-yl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane.
| Compound Name | (1S,3R,7R,8S,11S,12S,15R,16R)-15-[(2R,5S)-5,6-dimethylheptan-2-yl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane |
|---|---|
| PubChem CID | 91746588 |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | (1S,3R,7R,8S,11S,12S,15R,16R)-15-[(2R,5S)-5,6-dimethylheptan-2-yl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane |
| SMILES | CC(C)[C@@H](C)CC[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4[C@H](C)CCC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C30H52/c1-20(2)21(3)10-11-23(5)24-14-16-28(7)26-13-12-25-22(4)9-8-15-29(25)19-30(26,29)18-17-27(24,28)6/h20-26H,8-19H2,1-7H3/t21-,22+,23+,24+,25-,26-,27+,28-,29+,30-/m0/s1 |
| InChIKey | GYQYLPXFYDCSFX-PKWXLGMGSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |