C34H56O2 — CID 162950670
[(1R,3R,6S,7S,8R,11R,12S,15R,16R)-7,12,16-trimethyl-15-[(2R,5R)-6-methyl-5-propan-2-ylhept-6-en-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate (PubChem CID 162950670) has the molecular formula C34H56O2 and a molecular weight of 496.82 g/mol. Its IUPAC name is [(1R,3R,6S,7S,8R,11R,12S,15R,16R)-7,12,16-trimethyl-15-[(2R,5R)-6-methyl-5-propan-2-ylhept-6-en-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate.
| Compound Name | [(1R,3R,6S,7S,8R,11R,12S,15R,16R)-7,12,16-trimethyl-15-[(2R,5R)-6-methyl-5-propan-2-ylhept-6-en-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
|---|---|
| PubChem CID | 162950670 |
| Molecular Formula | C34H56O2 |
| Molecular Weight | 496.82 g/mol |
| Exact Mass | 496.43 |
| IUPAC Name | [(1R,3R,6S,7S,8R,11R,12S,15R,16R)-7,12,16-trimethyl-15-[(2R,5R)-6-methyl-5-propan-2-ylhept-6-en-2-yl]-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
| SMILES | C=C(C)[C@H](CC[C@@H](C)[C@H]1CC[C@@]2(C)[C@H]3CC[C@@H]4[C@H](C)[C@@H](OC(C)=O)CC[C@@]45C[C@]35CC[C@]12C)C(C)C |
| InChI | InChI=1S/C34H56O2/c1-21(2)26(22(3)4)11-10-23(5)27-14-16-32(9)30-13-12-28-24(6)29(36-25(7)35)15-17-33(28)20-34(30,33)19-18-31(27,32)8/h22-24,26-30H,1,10-20H2,2-9H3/t23-,24+,26+,27-,28-,29+,30-,31-,32+,33-,34-/m1/s1 |
| InChIKey | CFCDWJUKFDUOGZ-IAUHBXLLSA-N |
| XLogP | 9.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.82 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|