C41H60O3 — CID 162926955
[(1S,3R,6S,7S,8S,11R,12S,15R,16R)-15-[(2R,5R)-5-ethyl-5,6-dimethylhept-6-en-2-yl]-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 162926955) has the molecular formula C41H60O3 and a molecular weight of 600.93 g/mol. Its IUPAC name is [(1S,3R,6S,7S,8S,11R,12S,15R,16R)-15-[(2R,5R)-5-ethyl-5,6-dimethylhept-6-en-2-yl]-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(1S,3R,6S,7S,8S,11R,12S,15R,16R)-15-[(2R,5R)-5-ethyl-5,6-dimethylhept-6-en-2-yl]-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162926955 |
| Molecular Formula | C41H60O3 |
| Molecular Weight | 600.93 g/mol |
| Exact Mass | 600.45 |
| IUPAC Name | [(1S,3R,6S,7S,8S,11R,12S,15R,16R)-15-[(2R,5R)-5-ethyl-5,6-dimethylhept-6-en-2-yl]-7,12,16-trimethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C=C(C)[C@](C)(CC)CC[C@@H](C)[C@H]1CC[C@@]2(C)[C@H]3CC[C@H]4[C@H](C)[C@@H](OC(=O)C=Cc5ccc(O)cc5)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C41H60O3/c1-9-37(6,27(2)3)21-18-28(4)32-19-22-39(8)35-16-15-33-29(5)34(44-36(43)17-12-30-10-13-31(42)14-11-30)20-23-40(33)26-41(35,40)25-24-38(32,39)7/h10-14,17,28-29,32-35,42H,2,9,15-16,18-26H2,1,3-8H3/t28-,29+,32-,33+,34+,35-,37-,38-,39+,40-,41+/m1/s1 |
| InChIKey | LXVXTMHMMKQUMB-YXPPAOIZSA-N |
| XLogP | 10.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.93 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|