C31H52O — CID 89137214
2,2-dimethyl-3-[(3R)-3-[(3R,6S,8S,11S,12S,16R)-6,7,7,12,16-pentamethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]butyl]oxirane (PubChem CID 89137214) has the molecular formula C31H52O and a molecular weight of 440.76 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(3R)-3-[(3R,6S,8S,11S,12S,16R)-6,7,7,12,16-pentamethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]butyl]oxirane.
| Compound Name | 2,2-dimethyl-3-[(3R)-3-[(3R,6S,8S,11S,12S,16R)-6,7,7,12,16-pentamethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]butyl]oxirane |
|---|---|
| PubChem CID | 89137214 |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.40 |
| IUPAC Name | 2,2-dimethyl-3-[(3R)-3-[(3R,6S,8S,11S,12S,16R)-6,7,7,12,16-pentamethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]butyl]oxirane |
| SMILES | C[C@H](CCC1OC1(C)C)C1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](C)CC[C@@]45CC35CC[C@]12C |
| InChI | InChI=1S/C31H52O/c1-20(9-12-25-27(5,6)32-25)22-14-15-29(8)24-11-10-23-26(3,4)21(2)13-16-30(23)19-31(24,30)18-17-28(22,29)7/h20-25H,9-19H2,1-8H3/t20-,21+,22?,23+,24+,25?,28-,29+,30-,31?/m1/s1 |
| InChIKey | JIFQGIKULWBVPM-DTMCDCGESA-N |
| XLogP | 8.66 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|