C26H46N2 — CID 46705406
(1S,3R,6S,8R,11S,15S,16R)-N,7,7,12,16-pentamethyl-15-[(1S)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine (PubChem CID 46705406) has the molecular formula C26H46N2 and a molecular weight of 386.67 g/mol. Its IUPAC name is (1S,3R,6S,8R,11S,15S,16R)-N,7,7,12,16-pentamethyl-15-[(1S)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine.
| Compound Name | (1S,3R,6S,8R,11S,15S,16R)-N,7,7,12,16-pentamethyl-15-[(1S)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine |
|---|---|
| PubChem CID | 46705406 |
| Molecular Formula | C26H46N2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.37 |
| IUPAC Name | (1S,3R,6S,8R,11S,15S,16R)-N,7,7,12,16-pentamethyl-15-[(1S)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine |
| SMILES | CN[C@@H](C)[C@H]1CCC2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](NC)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C26H46N2/c1-17(27-6)18-10-12-24(5)20-9-8-19-22(2,3)21(28-7)11-13-25(19)16-26(20,25)15-14-23(18,24)4/h17-21,27-28H,8-16H2,1-7H3/t17-,18+,19-,20-,21-,23+,24?,25+,26-/m0/s1 |
| InChIKey | AXGWYABSYNCIMX-KNHYNIEPSA-N |
| XLogP | 5.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |