C27H48N2O — CID 129316904
(1S,3R,12S,16R)-15-[1-(dimethylamino)ethyl]-7,7,12,16-tetramethyl-6-(methylamino)pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol (PubChem CID 129316904) has the molecular formula C27H48N2O and a molecular weight of 416.69 g/mol. Its IUPAC name is (1S,3R,12S,16R)-15-[1-(dimethylamino)ethyl]-7,7,12,16-tetramethyl-6-(methylamino)pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol.
| Compound Name | (1S,3R,12S,16R)-15-[1-(dimethylamino)ethyl]-7,7,12,16-tetramethyl-6-(methylamino)pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol |
|---|---|
| PubChem CID | 129316904 |
| Molecular Formula | C27H48N2O |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.38 |
| IUPAC Name | (1S,3R,12S,16R)-15-[1-(dimethylamino)ethyl]-7,7,12,16-tetramethyl-6-(methylamino)pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol |
| SMILES | CNC1CC[C@]23C[C@]24CC[C@]2(C)C(C(C)N(C)C)C(O)C[C@@]2(C)C4CCC3C1(C)C |
| InChI | InChI=1S/C27H48N2O/c1-17(29(7)8)22-18(30)15-25(5)20-10-9-19-23(2,3)21(28-6)11-12-26(19)16-27(20,26)14-13-24(22,25)4/h17-22,28,30H,9-16H2,1-8H3/t17?,18?,19?,20?,21?,22?,24-,25+,26-,27+/m1/s1 |
| InChIKey | IDOHCEDWHOEHNL-LJGMOQNISA-N |
| XLogP | 4.93 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |