C30H56N2O — CID 145053421
(12S,14R)-15-[1-(dimethylamino)ethyl]-14-methoxy-N,7,7,12,16-pentamethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine;ethane (PubChem CID 145053421) has the molecular formula C30H56N2O and a molecular weight of 460.79 g/mol. Its IUPAC name is (12S,14R)-15-[1-(dimethylamino)ethyl]-14-methoxy-N,7,7,12,16-pentamethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine;ethane.
| Compound Name | (12S,14R)-15-[1-(dimethylamino)ethyl]-14-methoxy-N,7,7,12,16-pentamethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine;ethane |
|---|---|
| PubChem CID | 145053421 |
| Molecular Formula | C30H56N2O |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 460.44 |
| IUPAC Name | (12S,14R)-15-[1-(dimethylamino)ethyl]-14-methoxy-N,7,7,12,16-pentamethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-amine;ethane |
| SMILES | CC.CNC1CCC23CC24CCC2(C)C(C(C)N(C)C)[C@H](OC)C[C@@]2(C)C4CCC3C1(C)C |
| InChI | InChI=1S/C28H50N2O.C2H6/c1-18(30(7)8)23-19(31-9)16-26(5)21-11-10-20-24(2,3)22(29-6)12-13-27(20)17-28(21,27)15-14-25(23,26)4;1-2/h18-23,29H,10-17H2,1-9H3;1-2H3/t18?,19-,20?,21?,22?,23?,25?,26+,27?,28?;/m1./s1 |
| InChIKey | UZRYGNZQFNTZKF-MDFFJFNASA-N |
| XLogP | 6.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |