C25H42N2O — CID 23912032
(1S,3S,6R,11R,15R,16S)-12,16-dimethyl-6-(methylamino)-15-[1-(methylamino)ethyl]-7-methylidenepentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol (PubChem CID 23912032) has the molecular formula C25H42N2O and a molecular weight of 386.62 g/mol. Its IUPAC name is (1S,3S,6R,11R,15R,16S)-12,16-dimethyl-6-(methylamino)-15-[1-(methylamino)ethyl]-7-methylidenepentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol.
| Compound Name | (1S,3S,6R,11R,15R,16S)-12,16-dimethyl-6-(methylamino)-15-[1-(methylamino)ethyl]-7-methylidenepentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol |
|---|---|
| PubChem CID | 23912032 |
| Molecular Formula | C25H42N2O |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.33 |
| IUPAC Name | (1S,3S,6R,11R,15R,16S)-12,16-dimethyl-6-(methylamino)-15-[1-(methylamino)ethyl]-7-methylidenepentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol |
| SMILES | C=C1C2CC[C@@H]3C4(C)CC(O)[C@@H](C(C)NC)[C@]4(C)CC[C@]34C[C@@]24CC[C@H]1NC |
| InChI | InChI=1S/C25H42N2O/c1-15-17-7-8-20-23(4)13-19(28)21(16(2)26-5)22(23,3)11-12-25(20)14-24(17,25)10-9-18(15)27-6/h16-21,26-28H,1,7-14H2,2-6H3/t16?,17?,18-,19?,20-,21-,22+,23?,24+,25+/m1/s1 |
| InChIKey | BSNZFQANPMIOIU-UAECXMTDSA-N |
| XLogP | 4.12 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|