C27H48N2O — CID 163004192
(1S,3R,6S,7S,8S,11R,12S,14R,15S,16R)-6-(ethylamino)-15-[(1S)-1-(ethylamino)ethyl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol (PubChem CID 163004192) has the molecular formula C27H48N2O and a molecular weight of 416.69 g/mol. Its IUPAC name is (1S,3R,6S,7S,8S,11R,12S,14R,15S,16R)-6-(ethylamino)-15-[(1S)-1-(ethylamino)ethyl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol.
| Compound Name | (1S,3R,6S,7S,8S,11R,12S,14R,15S,16R)-6-(ethylamino)-15-[(1S)-1-(ethylamino)ethyl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol |
|---|---|
| PubChem CID | 163004192 |
| Molecular Formula | C27H48N2O |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.38 |
| IUPAC Name | (1S,3R,6S,7S,8S,11R,12S,14R,15S,16R)-6-(ethylamino)-15-[(1S)-1-(ethylamino)ethyl]-7,12,16-trimethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol |
| SMILES | CCN[C@@H](C)[C@H]1[C@H](O)C[C@@]2(C)[C@H]3CC[C@H]4[C@H](C)[C@@H](NCC)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C27H48N2O/c1-7-28-18(4)23-21(30)15-25(6)22-10-9-19-17(3)20(29-8-2)11-12-26(19)16-27(22,26)14-13-24(23,25)5/h17-23,28-30H,7-16H2,1-6H3/t17-,18-,19-,20-,21+,22+,23-,24+,25-,26+,27-/m0/s1 |
| InChIKey | UHCFBQGPAUZDTC-HDTPANDVSA-N |
| XLogP | 4.98 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |