C38H74N2O — CID 145053621
(12S,14R)-6-[tert-butyl(methyl)amino]-15-[1-[tert-butyl(methyl)amino]ethyl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol;ethane (PubChem CID 145053621) has the molecular formula C38H74N2O and a molecular weight of 575.02 g/mol. Its IUPAC name is (12S,14R)-6-[tert-butyl(methyl)amino]-15-[1-[tert-butyl(methyl)amino]ethyl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol;ethane.
| Compound Name | (12S,14R)-6-[tert-butyl(methyl)amino]-15-[1-[tert-butyl(methyl)amino]ethyl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol;ethane |
|---|---|
| PubChem CID | 145053621 |
| Molecular Formula | C38H74N2O |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.58 |
| IUPAC Name | (12S,14R)-6-[tert-butyl(methyl)amino]-15-[1-[tert-butyl(methyl)amino]ethyl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol;ethane |
| SMILES | CC.CC.CC(C1[C@H](O)C[C@@]2(C)C3CCC4C(C)(C)C(N(C)C(C)(C)C)CCC45CC35CCC12C)N(C)C(C)(C)C |
| InChI | InChI=1S/C34H62N2O.2C2H6/c1-22(35(12)28(2,3)4)27-23(37)20-32(11)25-15-14-24-30(8,9)26(36(13)29(5,6)7)16-17-33(24)21-34(25,33)19-18-31(27,32)10;2*1-2/h22-27,37H,14-21H2,1-13H3;2*1-2H3/t22?,23-,24?,25?,26?,27?,31?,32+,33?,34?;;/m1../s1 |
| InChIKey | BDECFBSUCVRBSL-DKRYJPTDSA-N |
| XLogP | 9.67 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |