C30H52O5 — CID 15699905
(3S,6S)-6-[(1S,3R,6S,8R,11S,12S,14S,15R,16R)-6,14-dihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylheptane-2,3,6-triol (PubChem CID 15699905) has the molecular formula C30H52O5 and a molecular weight of 492.74 g/mol. Its IUPAC name is (3S,6S)-6-[(1S,3R,6S,8R,11S,12S,14S,15R,16R)-6,14-dihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylheptane-2,3,6-triol.
| Compound Name | (3S,6S)-6-[(1S,3R,6S,8R,11S,12S,14S,15R,16R)-6,14-dihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylheptane-2,3,6-triol |
|---|---|
| PubChem CID | 15699905 |
| Molecular Formula | C30H52O5 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | (3S,6S)-6-[(1S,3R,6S,8R,11S,12S,14S,15R,16R)-6,14-dihydroxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]-2-methylheptane-2,3,6-triol |
| SMILES | CC(C)(O)[C@@H](O)CC[C@](C)(O)[C@H]1[C@@H](O)C[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C30H52O5/c1-24(2)19-8-9-20-27(6)16-18(31)23(28(7,35)12-10-22(33)25(3,4)34)26(27,5)14-15-30(20)17-29(19,30)13-11-21(24)32/h18-23,31-35H,8-17H2,1-7H3/t18-,19-,20-,21-,22-,23-,26+,27-,28-,29+,30-/m0/s1 |
| InChIKey | BJFBYBQLDPYWNJ-AGDWXBCRSA-N |
| XLogP | 4.42 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |