C25H43NO2 — CID 162868870
(1S,3R,6S,8R,11S,12S,14R,15S,16R)-7,7,12,16-tetramethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,14-diol (PubChem CID 162868870) has the molecular formula C25H43NO2 and a molecular weight of 389.62 g/mol. Its IUPAC name is (1S,3R,6S,8R,11S,12S,14R,15S,16R)-7,7,12,16-tetramethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,14-diol.
| Compound Name | (1S,3R,6S,8R,11S,12S,14R,15S,16R)-7,7,12,16-tetramethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,14-diol |
|---|---|
| PubChem CID | 162868870 |
| Molecular Formula | C25H43NO2 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 389.33 |
| IUPAC Name | (1S,3R,6S,8R,11S,12S,14R,15S,16R)-7,7,12,16-tetramethyl-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,14-diol |
| SMILES | CN[C@H](C)[C@H]1[C@H](O)C[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C25H43NO2/c1-15(26-6)20-16(27)13-23(5)18-8-7-17-21(2,3)19(28)9-10-24(17)14-25(18,24)12-11-22(20,23)4/h15-20,26-28H,7-14H2,1-6H3/t15-,16-,17+,18+,19+,20+,22-,23+,24-,25+/m1/s1 |
| InChIKey | KHBOEHDNAZWJMH-ZGILUUTNSA-N |
| XLogP | 4.37 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |