C28H48N2O2 — CID 101280232
(1R,3S,6R,7S,8R,10S,11S,14R,15S,20S)-6,10,15,18,19-pentamethyl-7-[(1S)-1-(methylamino)ethyl]-17-oxa-19-azahexacyclo[12.8.0.01,3.03,11.06,10.015,20]docosan-8-ol (PubChem CID 101280232) has the molecular formula C28H48N2O2 and a molecular weight of 444.70 g/mol. Its IUPAC name is (1R,3S,6R,7S,8R,10S,11S,14R,15S,20S)-6,10,15,18,19-pentamethyl-7-[(1S)-1-(methylamino)ethyl]-17-oxa-19-azahexacyclo[12.8.0.01,3.03,11.06,10.015,20]docosan-8-ol.
| Compound Name | (1R,3S,6R,7S,8R,10S,11S,14R,15S,20S)-6,10,15,18,19-pentamethyl-7-[(1S)-1-(methylamino)ethyl]-17-oxa-19-azahexacyclo[12.8.0.01,3.03,11.06,10.015,20]docosan-8-ol |
|---|---|
| PubChem CID | 101280232 |
| Molecular Formula | C28H48N2O2 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.37 |
| IUPAC Name | (1R,3S,6R,7S,8R,10S,11S,14R,15S,20S)-6,10,15,18,19-pentamethyl-7-[(1S)-1-(methylamino)ethyl]-17-oxa-19-azahexacyclo[12.8.0.01,3.03,11.06,10.015,20]docosan-8-ol |
| SMILES | CN[C@@H](C)[C@H]1[C@H](O)C[C@@]2(C)[C@@H]3CC[C@H]4[C@]5(C)COC(C)N(C)[C@H]5CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C28H48N2O2/c1-17(29-6)23-19(31)14-26(5)21-9-8-20-24(3)16-32-18(2)30(7)22(24)10-11-27(20)15-28(21,27)13-12-25(23,26)4/h17-23,29,31H,8-16H2,1-7H3/t17-,18?,19+,20-,21-,22-,23-,24-,25+,26-,27+,28-/m0/s1 |
| InChIKey | YKTMROCWPCFGFP-VOMMVQKPSA-N |
| XLogP | 4.66 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |