C30H48O4 — CID 45048779
(1R,19S)-3,8,8,17,19-pentamethyl-21-propan-2-yl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosane-2,9-diol (PubChem CID 45048779) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is (1R,19S)-3,8,8,17,19-pentamethyl-21-propan-2-yl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosane-2,9-diol.
| Compound Name | (1R,19S)-3,8,8,17,19-pentamethyl-21-propan-2-yl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosane-2,9-diol |
|---|---|
| PubChem CID | 45048779 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | (1R,19S)-3,8,8,17,19-pentamethyl-21-propan-2-yl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosane-2,9-diol |
| SMILES | CC1CC2(C(C)C)CO[C@@]3(O2)C1C1(C)CCC24CC25CCC(O)C(C)(C)C5CCC4C1(C)C3O |
| InChI | InChI=1S/C30H48O4/c1-17(2)29-14-18(3)22-25(6)12-13-28-15-27(28)11-10-21(31)24(4,5)19(27)8-9-20(28)26(25,7)23(32)30(22,34-29)33-16-29/h17-23,31-32H,8-16H2,1-7H3/t18?,19?,20?,21?,22?,23?,25?,26?,27?,28?,29?,30-/m1/s1 |
| InChIKey | SUGCQRXFUUJLDY-OPJGURERSA-N |
| XLogP | 5.54 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |