C28H47NO5S — CID 158142992
N-[[(1S,4R,5R,6R,11R,12S,16R,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]methanesulfonamide (PubChem CID 158142992) has the molecular formula C28H47NO5S and a molecular weight of 509.75 g/mol. Its IUPAC name is N-[[(1S,4R,5R,6R,11R,12S,16R,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(1S,4R,5R,6R,11R,12S,16R,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 158142992 |
| Molecular Formula | C28H47NO5S |
| Molecular Weight | 509.75 g/mol |
| Exact Mass | 509.32 |
| IUPAC Name | N-[[(1S,4R,5R,6R,11R,12S,16R,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]methanesulfonamide |
| SMILES | C[C@@H]1CC(CNS(C)(=O)=O)OC2[C@H]1[C@@]1(C)CC[C@@]34C[C@@]35CCC(O)C(C)(C)[C@@H]5CCC4[C@]1(C)[C@H]2O |
| InChI | InChI=1S/C28H47NO5S/c1-16-13-17(14-29-35(6,32)33)34-22-21(16)25(4)11-12-28-15-27(28)10-9-20(30)24(2,3)18(27)7-8-19(28)26(25,5)23(22)31/h16-23,29-31H,7-15H2,1-6H3/t16-,17?,18+,19?,20?,21+,22?,23+,25-,26-,27-,28+/m1/s1 |
| InChIKey | VBNZYPZJJALMHZ-HFCHDRJVSA-N |
| XLogP | 3.71 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.75 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |