C31H52N2O4 — CID 89435970
1-[[(4R,5R,6R,11R,12S,16R,18S,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]-1,3,3-trimethylurea (PubChem CID 89435970) has the molecular formula C31H52N2O4 and a molecular weight of 516.77 g/mol. Its IUPAC name is 1-[[(4R,5R,6R,11R,12S,16R,18S,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]-1,3,3-trimethylurea.
| Compound Name | 1-[[(4R,5R,6R,11R,12S,16R,18S,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 89435970 |
| Molecular Formula | C31H52N2O4 |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.39 |
| IUPAC Name | 1-[[(4R,5R,6R,11R,12S,16R,18S,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]-1,3,3-trimethylurea |
| SMILES | C[C@@H]1CC(CN(C)C(=O)N(C)C)OC2[C@H]1[C@@]1(C)CCC34C[C@@]35CC[C@H](O)C(C)(C)[C@@H]5CCC4[C@]1(C)[C@H]2O |
| InChI | InChI=1S/C31H52N2O4/c1-18-15-19(16-33(8)26(36)32(6)7)37-24-23(18)28(4)13-14-31-17-30(31)12-11-22(34)27(2,3)20(30)9-10-21(31)29(28,5)25(24)35/h18-25,34-35H,9-17H2,1-8H3/t18-,19?,20+,21?,22+,23+,24?,25+,28-,29-,30-,31?/m1/s1 |
| InChIKey | OJMIVDDVCQTJGC-ISKIKEDQSA-N |
| XLogP | 4.77 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |