C35H52N2O4 — CID 163875539
N-[[(1S,4R,5R,6R,11R,12S,16R,18S)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 163875539) has the molecular formula C35H52N2O4 and a molecular weight of 564.81 g/mol. Its IUPAC name is N-[[(1S,4R,5R,6R,11R,12S,16R,18S)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | N-[[(1S,4R,5R,6R,11R,12S,16R,18S)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 163875539 |
| Molecular Formula | C35H52N2O4 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | N-[[(1S,4R,5R,6R,11R,12S,16R,18S)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]methyl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | CC(=O)N(Cc1ccccn1)CC1C[C@@H](C)[C@H]2C(O1)[C@H](O)[C@@]1(C)C3CC[C@H]4C(C)(C)[C@@H](O)CCC45C[C@@]35CC[C@]21C |
| InChI | InChI=1S/C35H52N2O4/c1-21-17-24(19-37(22(2)38)18-23-9-7-8-16-36-23)41-29-28(21)32(5)14-15-35-20-34(35)13-12-27(39)31(3,4)25(34)10-11-26(35)33(32,6)30(29)40/h7-9,16,21,24-30,39-40H,10-15,17-20H2,1-6H3/t21-,24?,25+,26?,27+,28+,29?,30+,32-,33-,34?,35+/m1/s1 |
| InChIKey | PONKGOOEAFXLDA-IMPALVOCSA-N |
| XLogP | 5.60 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |