C27H42O5 — CID 71287472
(1S,4R,5R,6R,8R,10S,11R,12S,13R,16R,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8-carboxylic acid (PubChem CID 71287472) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is (1S,4R,5R,6R,8R,10S,11R,12S,13R,16R,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8-carboxylic acid.
| Compound Name | (1S,4R,5R,6R,8R,10S,11R,12S,13R,16R,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8-carboxylic acid |
|---|---|
| PubChem CID | 71287472 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | (1S,4R,5R,6R,8R,10S,11R,12S,13R,16R,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8-carboxylic acid |
| SMILES | C[C@@H]1C[C@H](C(=O)O)O[C@H]2[C@H]1[C@@]1(C)CC[C@@]34C[C@@]35CCC(O)C(C)(C)[C@@H]5CC[C@H]4[C@]1(C)[C@H]2O |
| InChI | InChI=1S/C27H42O5/c1-14-12-15(22(30)31)32-20-19(14)24(4)10-11-27-13-26(27)9-8-18(28)23(2,3)16(26)6-7-17(27)25(24,5)21(20)29/h14-21,28-29H,6-13H2,1-5H3,(H,30,31)/t14-,15-,16+,17+,18?,19+,20+,21+,24-,25-,26-,27+/m1/s1 |
| InChIKey | OECYGUVWJIOUMP-BLCPGSCFSA-N |
| XLogP | 4.25 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |