C30H49NO4 — CID 71289461
N-[2-[(4R,6R,11R,12S,13R,16R,18S,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]ethyl]acetamide (PubChem CID 71289461) has the molecular formula C30H49NO4 and a molecular weight of 487.73 g/mol. Its IUPAC name is N-[2-[(4R,6R,11R,12S,13R,16R,18S,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]ethyl]acetamide.
| Compound Name | N-[2-[(4R,6R,11R,12S,13R,16R,18S,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 71289461 |
| Molecular Formula | C30H49NO4 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.37 |
| IUPAC Name | N-[2-[(4R,6R,11R,12S,13R,16R,18S,21R)-11,18-dihydroxy-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCC1CC(C)C2C(O1)[C@H](O)[C@@]1(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@@]45CC35CC[C@]21C |
| InChI | InChI=1S/C30H49NO4/c1-17-15-19(10-14-31-18(2)32)35-24-23(17)27(5)12-13-30-16-29(30)11-9-22(33)26(3,4)20(29)7-8-21(30)28(27,6)25(24)34/h17,19-25,33-34H,7-16H2,1-6H3,(H,31,32)/t17?,19?,20-,21-,22-,23?,24?,25-,27+,28+,29+,30?/m0/s1 |
| InChIKey | CWDROJZGEHDALK-FMQIAVSQSA-N |
| XLogP | 4.69 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |