C31H48O4 — CID 163030669
(1S,2R,3S,4R,7S,9S,12R,14S,17R,18R,19R,21R,22R)-2-methoxy-3,8,8,17,19-pentamethyl-22-prop-1-en-2-yl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-9-ol (PubChem CID 163030669) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is (1S,2R,3S,4R,7S,9S,12R,14S,17R,18R,19R,21R,22R)-2-methoxy-3,8,8,17,19-pentamethyl-22-prop-1-en-2-yl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-9-ol.
| Compound Name | (1S,2R,3S,4R,7S,9S,12R,14S,17R,18R,19R,21R,22R)-2-methoxy-3,8,8,17,19-pentamethyl-22-prop-1-en-2-yl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-9-ol |
|---|---|
| PubChem CID | 163030669 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | (1S,2R,3S,4R,7S,9S,12R,14S,17R,18R,19R,21R,22R)-2-methoxy-3,8,8,17,19-pentamethyl-22-prop-1-en-2-yl-23,24-dioxaheptacyclo[19.2.1.01,18.03,17.04,14.07,12.012,14]tetracosan-9-ol |
| SMILES | C=C(C)[C@H]1O[C@@]23O[C@@H]1C[C@@H](C)[C@@H]2[C@@]1(C)CC[C@@]24C[C@@]25CC[C@H](O)C(C)(C)[C@H]5CC[C@H]4[C@]1(C)[C@H]3OC |
| InChI | InChI=1S/C31H48O4/c1-17(2)23-19-15-18(3)24-27(6)13-14-30-16-29(30)12-11-22(32)26(4,5)20(29)9-10-21(30)28(27,7)25(33-8)31(24,34-19)35-23/h18-25,32H,1,9-16H2,2-8H3/t18-,19-,20-,21+,22+,23-,24-,25-,27-,28-,29-,30+,31+/m1/s1 |
| InChIKey | ZXZGAOUJNZOUEW-VLHNOEEOSA-N |
| XLogP | 6.12 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|