C26H46N2O — CID 124512245
(1S,3R,6S,8R,11S,12S,14R,15S,16R)-7,7,12,16-tetramethyl-6-(methylamino)-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol (PubChem CID 124512245) has the molecular formula C26H46N2O and a molecular weight of 402.67 g/mol. Its IUPAC name is (1S,3R,6S,8R,11S,12S,14R,15S,16R)-7,7,12,16-tetramethyl-6-(methylamino)-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol.
| Compound Name | (1S,3R,6S,8R,11S,12S,14R,15S,16R)-7,7,12,16-tetramethyl-6-(methylamino)-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol |
|---|---|
| PubChem CID | 124512245 |
| Molecular Formula | C26H46N2O |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 402.36 |
| IUPAC Name | (1S,3R,6S,8R,11S,12S,14R,15S,16R)-7,7,12,16-tetramethyl-6-(methylamino)-15-[(1R)-1-(methylamino)ethyl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecan-14-ol |
| SMILES | CN[C@H]1CC[C@]23C[C@]24CC[C@]2(C)[C@@H]([C@@H](C)NC)[C@H](O)C[C@@]2(C)[C@@H]4CC[C@H]3C1(C)C |
| InChI | InChI=1S/C26H46N2O/c1-16(27-6)21-17(29)14-24(5)19-9-8-18-22(2,3)20(28-7)10-11-25(18)15-26(19,25)13-12-23(21,24)4/h16-21,27-29H,8-15H2,1-7H3/t16-,17-,18+,19+,20+,21+,23-,24+,25-,26+/m1/s1 |
| InChIKey | GMNAPBAUIVITMI-JTEXPBFISA-N |
| XLogP | 4.59 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |