C26H43NO2 — CID 139368463
1-[(1R,3R,6S,8R,11S,12S,15R,16S)-15-hydroxy-7,7,12,14,16-pentamethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]ethanone (PubChem CID 139368463) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is 1-[(1R,3R,6S,8R,11S,12S,15R,16S)-15-hydroxy-7,7,12,14,16-pentamethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]ethanone.
| Compound Name | 1-[(1R,3R,6S,8R,11S,12S,15R,16S)-15-hydroxy-7,7,12,14,16-pentamethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]ethanone |
|---|---|
| PubChem CID | 139368463 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | 1-[(1R,3R,6S,8R,11S,12S,15R,16S)-15-hydroxy-7,7,12,14,16-pentamethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]ethanone |
| SMILES | CN[C@H]1CC[C@]23C[C@@]24CC[C@]2(C)[C@@](O)(C(C)=O)C(C)C[C@@]2(C)[C@@H]4CC[C@H]3C1(C)C |
| InChI | InChI=1S/C26H43NO2/c1-16-14-22(5)19-9-8-18-21(3,4)20(27-7)10-11-24(18)15-25(19,24)13-12-23(22,6)26(16,29)17(2)28/h16,18-20,27,29H,8-15H2,1-7H3/t16?,18-,19-,20-,22-,23-,24+,25+,26-/m0/s1 |
| InChIKey | AOVPQRGUHQFACJ-KVZWSPEMSA-N |
| XLogP | 4.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |