C27H41NO3 — CID 139380721
[2-oxo-2-[(1S,3R,6S,8R,11S,12S,16S)-7,7,12,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethyl] acetate (PubChem CID 139380721) has the molecular formula C27H41NO3 and a molecular weight of 427.63 g/mol. Its IUPAC name is [2-oxo-2-[(1S,3R,6S,8R,11S,12S,16S)-7,7,12,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethyl] acetate.
| Compound Name | [2-oxo-2-[(1S,3R,6S,8R,11S,12S,16S)-7,7,12,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethyl] acetate |
|---|---|
| PubChem CID | 139380721 |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | [2-oxo-2-[(1S,3R,6S,8R,11S,12S,16S)-7,7,12,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethyl] acetate |
| SMILES | CN[C@H]1CC[C@]23C[C@]24CC[C@]2(C)C(C(=O)COC(C)=O)=CC[C@@]2(C)[C@@H]4CC[C@H]3C1(C)C |
| InChI | InChI=1S/C27H41NO3/c1-17(29)31-15-19(30)18-9-11-25(5)21-8-7-20-23(2,3)22(28-6)10-12-26(20)16-27(21,26)14-13-24(18,25)4/h9,20-22,28H,7-8,10-16H2,1-6H3/t20-,21-,22-,24+,25-,26+,27-/m0/s1 |
| InChIKey | IGEBHQBRAITKEG-SZOUBDJTSA-N |
| XLogP | 5.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |