C25H35NO2 — CID 163105493
N-(15-acetyl-12,16-dimethyl-7-methylidene-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl)-N-methylformamide (PubChem CID 163105493) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is N-(15-acetyl-12,16-dimethyl-7-methylidene-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl)-N-methylformamide.
| Compound Name | N-(15-acetyl-12,16-dimethyl-7-methylidene-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl)-N-methylformamide |
|---|---|
| PubChem CID | 163105493 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | N-(15-acetyl-12,16-dimethyl-7-methylidene-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl)-N-methylformamide |
| SMILES | C=C1C(N(C)C=O)CCC23CC24CCC2(C)C(C(C)=O)=CCC2(C)C4CCC13 |
| InChI | InChI=1S/C25H35NO2/c1-16-18-6-7-21-23(4)10-8-19(17(2)28)22(23,3)12-13-25(21)14-24(18,25)11-9-20(16)26(5)15-27/h8,15,18,20-21H,1,6-7,9-14H2,2-5H3 |
| InChIKey | PEGHGSZQFPWEFQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|