C27H44N2O2 — CID 142335404
acetaldehyde;15-[(Z)-N-methoxy-C-methylcarbonimidoyl]-N,7,7,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-en-6-amine (PubChem CID 142335404) has the molecular formula C27H44N2O2 and a molecular weight of 428.66 g/mol. Its IUPAC name is acetaldehyde;15-[(Z)-N-methoxy-C-methylcarbonimidoyl]-N,7,7,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-en-6-amine.
| Compound Name | acetaldehyde;15-[(Z)-N-methoxy-C-methylcarbonimidoyl]-N,7,7,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-en-6-amine |
|---|---|
| PubChem CID | 142335404 |
| Molecular Formula | C27H44N2O2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | acetaldehyde;15-[(Z)-N-methoxy-C-methylcarbonimidoyl]-N,7,7,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-en-6-amine |
| SMILES | CC=O.CNC1CCC23CC24CCC2(C)C(/C(C)=N\OC)=CCC2C4CCC3C1(C)C |
| InChI | InChI=1S/C25H40N2O.C2H4O/c1-16(27-28-6)17-7-8-18-19-9-10-20-22(2,3)21(26-5)11-12-25(20)15-24(19,25)14-13-23(17,18)4;1-2-3/h7,18-21,26H,8-15H2,1-6H3;2H,1H3/b27-16-; |
| InChIKey | JANFXPJDGMXJHG-FYAJYVDZSA-N |
| XLogP | 5.77 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|