C25H41NO — CID 142335384
1-[2,7,7,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethanol (PubChem CID 142335384) has the molecular formula C25H41NO and a molecular weight of 371.61 g/mol. Its IUPAC name is 1-[2,7,7,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethanol.
| Compound Name | 1-[2,7,7,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethanol |
|---|---|
| PubChem CID | 142335384 |
| Molecular Formula | C25H41NO |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.32 |
| IUPAC Name | 1-[2,7,7,16-tetramethyl-6-(methylamino)-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-14-enyl]ethanol |
| SMILES | CNC1CCC23C(CCC4C5CC=C(C(C)O)C5(C)CCC42C3C)C1(C)C |
| InChI | InChI=1S/C25H41NO/c1-15(27)17-7-8-18-19-9-10-20-22(3,4)21(26-6)11-12-25(20)16(2)24(19,25)14-13-23(17,18)5/h7,15-16,18-21,26-27H,8-14H2,1-6H3 |
| InChIKey | VUIQSPUMBGPEDU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|