C31H52 — CID 145498691
(12S,15E)-2,6,7,7,12,16-hexamethyl-15-(5-methylhexylidene)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane (PubChem CID 145498691) has the molecular formula C31H52 and a molecular weight of 424.76 g/mol. Its IUPAC name is (12S,15E)-2,6,7,7,12,16-hexamethyl-15-(5-methylhexylidene)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane.
| Compound Name | (12S,15E)-2,6,7,7,12,16-hexamethyl-15-(5-methylhexylidene)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane |
|---|---|
| PubChem CID | 145498691 |
| Molecular Formula | C31H52 |
| Molecular Weight | 424.76 g/mol |
| Exact Mass | 424.41 |
| IUPAC Name | (12S,15E)-2,6,7,7,12,16-hexamethyl-15-(5-methylhexylidene)pentacyclo[9.7.0.01,3.03,8.012,16]octadecane |
| SMILES | CC(C)CCC/C=C1\CC[C@@]2(C)C3CCC4C(C)(C)C(C)CCC45C(C)C35CCC12C |
| InChI | InChI=1S/C31H52/c1-21(2)11-9-10-12-24-16-17-29(8)26-14-13-25-27(5,6)22(3)15-18-30(25)23(4)31(26,30)20-19-28(24,29)7/h12,21-23,25-26H,9-11,13-20H2,1-8H3/b24-12+/t22?,23?,25?,26?,28?,29-,30?,31?/m0/s1 |
| InChIKey | GPCSKKPXISBGPS-MJMXKPTPSA-N |
| XLogP | 9.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.76 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|