C31H55N — CID 144759455
(1E)-7-butyl-9a,11a-dimethyl-1-(5-methylhexylidene)-3,3a,3b,4,6,8,9,9b,10,11-decahydro-2H-indeno[5,4-f]isoquinoline;ethane (PubChem CID 144759455) has the molecular formula C31H55N and a molecular weight of 441.79 g/mol. Its IUPAC name is (1E)-7-butyl-9a,11a-dimethyl-1-(5-methylhexylidene)-3,3a,3b,4,6,8,9,9b,10,11-decahydro-2H-indeno[5,4-f]isoquinoline;ethane.
| Compound Name | (1E)-7-butyl-9a,11a-dimethyl-1-(5-methylhexylidene)-3,3a,3b,4,6,8,9,9b,10,11-decahydro-2H-indeno[5,4-f]isoquinoline;ethane |
|---|---|
| PubChem CID | 144759455 |
| Molecular Formula | C31H55N |
| Molecular Weight | 441.79 g/mol |
| Exact Mass | 441.43 |
| IUPAC Name | (1E)-7-butyl-9a,11a-dimethyl-1-(5-methylhexylidene)-3,3a,3b,4,6,8,9,9b,10,11-decahydro-2H-indeno[5,4-f]isoquinoline;ethane |
| SMILES | CC.CCCCN1CCC2(C)C(=CCC3C2CCC2(C)/C(=C/CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C29H49N.C2H6/c1-6-7-19-30-20-18-29(5)24(21-30)12-14-25-26-15-13-23(11-9-8-10-22(2)3)28(26,4)17-16-27(25)29;1-2/h11-12,22,25-27H,6-10,13-21H2,1-5H3;1-2H3/b23-11+; |
| InChIKey | UZJYQJYIEJOQST-YDLOHEMZSA-N |
| XLogP | 9.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.79 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|