C32H54O2Si — CID 139263508
tert-butyl-[[(1R,3S,5R,6E,7S,10S,11R,14S)-7,11-dimethyl-6-(5-methylhexylidene)-4-oxapentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-en-14-yl]oxy]-dimethylsilane (PubChem CID 139263508) has the molecular formula C32H54O2Si and a molecular weight of 498.87 g/mol. Its IUPAC name is tert-butyl-[[(1R,3S,5R,6E,7S,10S,11R,14S)-7,11-dimethyl-6-(5-methylhexylidene)-4-oxapentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-en-14-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,3S,5R,6E,7S,10S,11R,14S)-7,11-dimethyl-6-(5-methylhexylidene)-4-oxapentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-en-14-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 139263508 |
| Molecular Formula | C32H54O2Si |
| Molecular Weight | 498.87 g/mol |
| Exact Mass | 498.39 |
| IUPAC Name | tert-butyl-[[(1R,3S,5R,6E,7S,10S,11R,14S)-7,11-dimethyl-6-(5-methylhexylidene)-4-oxapentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-en-14-yl]oxy]-dimethylsilane |
| SMILES | CC(C)CCC/C=C1/[C@H]2OC2C2[C@@H]3CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H54O2Si/c1-21(2)12-10-11-13-26-28-29(33-28)27-24-15-14-22-20-23(34-35(8,9)30(3,4)5)16-18-31(22,6)25(24)17-19-32(26,27)7/h13-14,21,23-25,27-29H,10-12,15-20H2,1-9H3/b26-13-/t23-,24+,25-,27?,28+,29?,31-,32+/m0/s1 |
| InChIKey | PBIIAPLCHOBQSS-LBZSFTFRSA-N |
| XLogP | 9.08 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.87 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|